C16H21NO2 — CID 156637776
1,3-dimethyl-4-phenylmethoxypyridin-2-one;ethane (PubChem CID 156637776) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 1,3-dimethyl-4-phenylmethoxypyridin-2-one;ethane.
| Compound Name | 1,3-dimethyl-4-phenylmethoxypyridin-2-one;ethane |
|---|---|
| PubChem CID | 156637776 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 1,3-dimethyl-4-phenylmethoxypyridin-2-one;ethane |
| SMILES | CC.Cc1c(OCc2ccccc2)ccn(C)c1=O |
| InChI | InChI=1S/C14H15NO2.C2H6/c1-11-13(8-9-15(2)14(11)16)17-10-12-6-4-3-5-7-12;1-2/h3-9H,10H2,1-2H3;1-2H3 |
| InChIKey | ZRWDOJLLDRHXEK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |