About ethane;1,5,6-trimethyl-4-(trifluoromethyl)pyridin-2-one
ethane;1,5,6-trimethyl-4-(trifluoromethyl)pyridin-2-one (PubChem CID 156638572) has the molecular formula C11H16F3NO
and a molecular weight of 235.25 g/mol. Its IUPAC name is ethane;1,5,6-trimethyl-4-(trifluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | ethane;1,5,6-trimethyl-4-(trifluoromethyl)pyridin-2-one |
| PubChem CID | 156638572 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | ethane;1,5,6-trimethyl-4-(trifluoromethyl)pyridin-2-one |
| SMILES | CC.Cc1c(C(F)(F)F)cc(=O)n(C)c1C |
| InChI | InChI=1S/C9H10F3NO.C2H6/c1-5-6(2)13(3)8(14)4-7(5)9(10,11)12;1-2/h4H,1-3H3;1-2H3 |
| InChIKey | PHCIPBFKVQUAII-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1,5,6-trimethyl-4-(trifluoromethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1,5,6-trimethyl-4-(trifluoromethyl)pyridin-2-one?
The IUPAC name of ethane;1,5,6-trimethyl-4-(trifluoromethyl)pyridin-2-one (CID 156638572) is ethane;1,5,6-trimethyl-4-(trifluoromethyl)pyridin-2-one.
What is the SMILES notation for ethane;1,5,6-trimethyl-4-(trifluoromethyl)pyridin-2-one?
The canonical SMILES for ethane;1,5,6-trimethyl-4-(trifluoromethyl)pyridin-2-one is CC.Cc1c(C(F)(F)F)cc(=O)n(C)c1C.
What is the InChIKey of ethane;1,5,6-trimethyl-4-(trifluoromethyl)pyridin-2-one?
The InChIKey is PHCIPBFKVQUAII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F3NO.C2H6/c1-5-6(2)13(3)8(14)4-7(5)9(10,11)12;1-2/h4H,1-3H3;1-2H3.
What are the key properties of ethane;1,5,6-trimethyl-4-(trifluoromethyl)pyridin-2-one?
ethane;1,5,6-trimethyl-4-(trifluoromethyl)pyridin-2-one has a molecular weight of 235.25 g/mol, XLogP of 3.05, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1,5,6-trimethyl-4-(trifluoromethyl)pyridin-2-one is sourced from PubChem (CID 156638572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).