C21H29BrFN5O3S — CID 156638766
N-[[2-[(4S)-4-(3-aminopropyl)-2,2-dimethylpyrrolidin-1-yl]-6-bromo-3-pyridinyl]-methoxymethyl]-6-fluoropyridine-2-sulfonamide (PubChem CID 156638766) has the molecular formula C21H29BrFN5O3S and a molecular weight of 530.46 g/mol. Its IUPAC name is N-[[2-[(4S)-4-(3-aminopropyl)-2,2-dimethylpyrrolidin-1-yl]-6-bromo-3-pyridinyl]-methoxymethyl]-6-fluoropyridine-2-sulfonamide.
| Compound Name | N-[[2-[(4S)-4-(3-aminopropyl)-2,2-dimethylpyrrolidin-1-yl]-6-bromo-3-pyridinyl]-methoxymethyl]-6-fluoropyridine-2-sulfonamide |
|---|---|
| PubChem CID | 156638766 |
| Molecular Formula | C21H29BrFN5O3S |
| Molecular Weight | 530.46 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | N-[[2-[(4S)-4-(3-aminopropyl)-2,2-dimethylpyrrolidin-1-yl]-6-bromo-3-pyridinyl]-methoxymethyl]-6-fluoropyridine-2-sulfonamide |
| SMILES | COC(NS(=O)(=O)c1cccc(F)n1)c1ccc(Br)nc1N1C[C@@H](CCCN)CC1(C)C |
| InChI | InChI=1S/C21H29BrFN5O3S/c1-21(2)12-14(6-5-11-24)13-28(21)19-15(9-10-16(22)25-19)20(31-3)27-32(29,30)18-8-4-7-17(23)26-18/h4,7-10,14,20,27H,5-6,11-13,24H2,1-3H3/t14-,20?/m0/s1 |
| InChIKey | YDEWNBPXDSSDFZ-PVCZSOGJSA-N |
| XLogP | 3.35 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|