About ethane;3-(3-hydroxypropyl)-5,5-dimethylpyrrolidin-2-one
ethane;3-(3-hydroxypropyl)-5,5-dimethylpyrrolidin-2-one (PubChem CID 156638793) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is ethane;3-(3-hydroxypropyl)-5,5-dimethylpyrrolidin-2-one.
Molecular Properties
| Compound Name | ethane;3-(3-hydroxypropyl)-5,5-dimethylpyrrolidin-2-one |
| PubChem CID | 156638793 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | ethane;3-(3-hydroxypropyl)-5,5-dimethylpyrrolidin-2-one |
| SMILES | CC.CC1(C)CC(CCCO)C(=O)N1 |
| InChI | InChI=1S/C9H17NO2.C2H6/c1-9(2)6-7(4-3-5-11)8(12)10-9;1-2/h7,11H,3-6H2,1-2H3,(H,10,12);1-2H3 |
| InChIKey | AIMMRLWVQVPBAI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-(3-hydroxypropyl)-5,5-dimethylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-(3-hydroxypropyl)-5,5-dimethylpyrrolidin-2-one?
The IUPAC name of ethane;3-(3-hydroxypropyl)-5,5-dimethylpyrrolidin-2-one (CID 156638793) is ethane;3-(3-hydroxypropyl)-5,5-dimethylpyrrolidin-2-one.
What is the SMILES notation for ethane;3-(3-hydroxypropyl)-5,5-dimethylpyrrolidin-2-one?
The canonical SMILES for ethane;3-(3-hydroxypropyl)-5,5-dimethylpyrrolidin-2-one is CC.CC1(C)CC(CCCO)C(=O)N1.
What is the InChIKey of ethane;3-(3-hydroxypropyl)-5,5-dimethylpyrrolidin-2-one?
The InChIKey is AIMMRLWVQVPBAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.C2H6/c1-9(2)6-7(4-3-5-11)8(12)10-9;1-2/h7,11H,3-6H2,1-2H3,(H,10,12);1-2H3.
What are the key properties of ethane;3-(3-hydroxypropyl)-5,5-dimethylpyrrolidin-2-one?
ethane;3-(3-hydroxypropyl)-5,5-dimethylpyrrolidin-2-one has a molecular weight of 201.31 g/mol, XLogP of 1.70, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-(3-hydroxypropyl)-5,5-dimethylpyrrolidin-2-one is sourced from PubChem (CID 156638793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).