C13H20IN4O6P — CID 156638810
ethyl 2-iodophosphanyl-5-oxo-1H-pyrazole-4-carboxylate;ethyl 3-oxo-1,2-dihydropyrazole-4-carboxylate;methane (PubChem CID 156638810) has the molecular formula C13H20IN4O6P and a molecular weight of 486.20 g/mol. Its IUPAC name is ethyl 2-iodophosphanyl-5-oxo-1H-pyrazole-4-carboxylate;ethyl 3-oxo-1,2-dihydropyrazole-4-carboxylate;methane.
| Compound Name | ethyl 2-iodophosphanyl-5-oxo-1H-pyrazole-4-carboxylate;ethyl 3-oxo-1,2-dihydropyrazole-4-carboxylate;methane |
|---|---|
| PubChem CID | 156638810 |
| Molecular Formula | C13H20IN4O6P |
| Molecular Weight | 486.20 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | ethyl 2-iodophosphanyl-5-oxo-1H-pyrazole-4-carboxylate;ethyl 3-oxo-1,2-dihydropyrazole-4-carboxylate;methane |
| SMILES | C.CCOC(=O)c1c[nH][nH]c1=O.CCOC(=O)c1cn(PI)[nH]c1=O |
| InChI | InChI=1S/C6H8IN2O3P.C6H8N2O3.CH4/c1-2-12-6(11)4-3-9(13-7)8-5(4)10;1-2-11-6(10)4-3-7-8-5(4)9;/h3,13H,2H2,1H3,(H,8,10);3H,2H2,1H3,(H2,7,8,9);1H4 |
| InChIKey | DPUIAWUNWJGVSH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|