About tert-butyl 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-4-(3-hydroxypropyl)-2-methylpyrrolidine-1-carboxylate
tert-butyl 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-4-(3-hydroxypropyl)-2-methylpyrrolidine-1-carboxylate (PubChem CID 156638919) has the molecular formula C20H33NO3
and a molecular weight of 335.49 g/mol. Its IUPAC name is tert-butyl 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-4-(3-hydroxypropyl)-2-methylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-4-(3-hydroxypropyl)-2-methylpyrrolidine-1-carboxylate |
| PubChem CID | 156638919 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | tert-butyl 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-4-(3-hydroxypropyl)-2-methylpyrrolidine-1-carboxylate |
| SMILES | C=C/C=C(\C=C)CC1(C)CC(CCCO)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H33NO3/c1-7-10-16(8-2)13-20(6)14-17(11-9-12-22)15-21(20)18(23)24-19(3,4)5/h7-8,10,17,22H,1-2,9,11-15H2,3-6H3/b16-10+ |
| InChIKey | NEQRSYJFMOTBIW-MHWRWJLKSA-N |
| XLogP | 4.46 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-4-(3-hydroxypropyl)-2-methylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-4-(3-hydroxypropyl)-2-methylpyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-4-(3-hydroxypropyl)-2-methylpyrrolidine-1-carboxylate (CID 156638919) is tert-butyl 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-4-(3-hydroxypropyl)-2-methylpyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-4-(3-hydroxypropyl)-2-methylpyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-4-(3-hydroxypropyl)-2-methylpyrrolidine-1-carboxylate is C=C/C=C(\C=C)CC1(C)CC(CCCO)CN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-4-(3-hydroxypropyl)-2-methylpyrrolidine-1-carboxylate?
The InChIKey is NEQRSYJFMOTBIW-MHWRWJLKSA-N. The full InChI is InChI=1S/C20H33NO3/c1-7-10-16(8-2)13-20(6)14-17(11-9-12-22)15-21(20)18(23)24-19(3,4)5/h7-8,10,17,22H,1-2,9,11-15H2,3-6H3/b16-10+.
What are the key properties of tert-butyl 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-4-(3-hydroxypropyl)-2-methylpyrrolidine-1-carboxylate?
tert-butyl 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-4-(3-hydroxypropyl)-2-methylpyrrolidine-1-carboxylate has a molecular weight of 335.49 g/mol, XLogP of 4.46, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-4-(3-hydroxypropyl)-2-methylpyrrolidine-1-carboxylate is sourced from PubChem (CID 156638919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).