C29H36BrFN6OS — CID 156638953
N-[[6-[[1-(6-bromo-2-pyridinyl)-3-(5,5-dimethylpyrrolidin-3-yl)propyl]amino]-2-pyridinyl]sulfanyl]-6-tert-butyl-2-fluoropyridine-3-carboxamide (PubChem CID 156638953) has the molecular formula C29H36BrFN6OS and a molecular weight of 615.62 g/mol. Its IUPAC name is N-[[6-[[1-(6-bromo-2-pyridinyl)-3-(5,5-dimethylpyrrolidin-3-yl)propyl]amino]-2-pyridinyl]sulfanyl]-6-tert-butyl-2-fluoropyridine-3-carboxamide.
| Compound Name | N-[[6-[[1-(6-bromo-2-pyridinyl)-3-(5,5-dimethylpyrrolidin-3-yl)propyl]amino]-2-pyridinyl]sulfanyl]-6-tert-butyl-2-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 156638953 |
| Molecular Formula | C29H36BrFN6OS |
| Molecular Weight | 615.62 g/mol |
| Exact Mass | 614.18 |
| IUPAC Name | N-[[6-[[1-(6-bromo-2-pyridinyl)-3-(5,5-dimethylpyrrolidin-3-yl)propyl]amino]-2-pyridinyl]sulfanyl]-6-tert-butyl-2-fluoropyridine-3-carboxamide |
| SMILES | CC1(C)CC(CCC(Nc2cccc(SNC(=O)c3ccc(C(C)(C)C)nc3F)n2)c2cccc(Br)n2)CN1 |
| InChI | InChI=1S/C29H36BrFN6OS/c1-28(2,3)22-15-13-19(26(31)35-22)27(38)37-39-25-11-7-10-24(36-25)34-21(20-8-6-9-23(30)33-20)14-12-18-16-29(4,5)32-17-18/h6-11,13,15,18,21,32H,12,14,16-17H2,1-5H3,(H,34,36)(H,37,38) |
| InChIKey | GGKPTZDGACVIPY-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.62 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|