C27H30FN5OS — CID 156639064
7-benzyl-8-fluoro-12,12-dimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one (PubChem CID 156639064) has the molecular formula C27H30FN5OS and a molecular weight of 491.64 g/mol. Its IUPAC name is 7-benzyl-8-fluoro-12,12-dimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one.
| Compound Name | 7-benzyl-8-fluoro-12,12-dimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one |
|---|---|
| PubChem CID | 156639064 |
| Molecular Formula | C27H30FN5OS |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 7-benzyl-8-fluoro-12,12-dimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one |
| SMILES | CC1(C)CC2CCCNc3cccc(n3)SNC(=O)c3cc(Cc4ccccc4)c(F)nc3N1C2 |
| InChI | InChI=1S/C27H30FN5OS/c1-27(2)16-19-10-7-13-29-22-11-6-12-23(30-22)35-32-26(34)21-15-20(14-18-8-4-3-5-9-18)24(28)31-25(21)33(27)17-19/h3-6,8-9,11-12,15,19H,7,10,13-14,16-17H2,1-2H3,(H,29,30)(H,32,34) |
| InChIKey | LCKQKSJWHSMXMB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|