About (NE)-N-[3-(1-iodosyl-5,5-dimethylpyrrolidin-3-yl)propylidene]-2-methylpropane-2-sulfinamide
(NE)-N-[3-(1-iodosyl-5,5-dimethylpyrrolidin-3-yl)propylidene]-2-methylpropane-2-sulfinamide (PubChem CID 156639217) has the molecular formula C13H25IN2O2S
and a molecular weight of 400.33 g/mol. Its IUPAC name is (NE)-N-[3-(1-iodosyl-5,5-dimethylpyrrolidin-3-yl)propylidene]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | (NE)-N-[3-(1-iodosyl-5,5-dimethylpyrrolidin-3-yl)propylidene]-2-methylpropane-2-sulfinamide |
| PubChem CID | 156639217 |
| Molecular Formula | C13H25IN2O2S |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | (NE)-N-[3-(1-iodosyl-5,5-dimethylpyrrolidin-3-yl)propylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC1(C)CC(CC/C=N/S(=O)C(C)(C)C)CN1I=O |
| InChI | InChI=1S/C13H25IN2O2S/c1-12(2,3)19(18)15-8-6-7-11-9-13(4,5)16(10-11)14-17/h8,11H,6-7,9-10H2,1-5H3/b15-8+ |
| InChIKey | IPGBSPBAGSVZNA-OVCLIPMQSA-N |
| XLogP | 3.63 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[3-(1-iodosyl-5,5-dimethylpyrrolidin-3-yl)propylidene]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[3-(1-iodosyl-5,5-dimethylpyrrolidin-3-yl)propylidene]-2-methylpropane-2-sulfinamide?
The IUPAC name of (NE)-N-[3-(1-iodosyl-5,5-dimethylpyrrolidin-3-yl)propylidene]-2-methylpropane-2-sulfinamide (CID 156639217) is (NE)-N-[3-(1-iodosyl-5,5-dimethylpyrrolidin-3-yl)propylidene]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for (NE)-N-[3-(1-iodosyl-5,5-dimethylpyrrolidin-3-yl)propylidene]-2-methylpropane-2-sulfinamide?
The canonical SMILES for (NE)-N-[3-(1-iodosyl-5,5-dimethylpyrrolidin-3-yl)propylidene]-2-methylpropane-2-sulfinamide is CC1(C)CC(CC/C=N/S(=O)C(C)(C)C)CN1I=O.
What is the InChIKey of (NE)-N-[3-(1-iodosyl-5,5-dimethylpyrrolidin-3-yl)propylidene]-2-methylpropane-2-sulfinamide?
The InChIKey is IPGBSPBAGSVZNA-OVCLIPMQSA-N. The full InChI is InChI=1S/C13H25IN2O2S/c1-12(2,3)19(18)15-8-6-7-11-9-13(4,5)16(10-11)14-17/h8,11H,6-7,9-10H2,1-5H3/b15-8+.
What are the key properties of (NE)-N-[3-(1-iodosyl-5,5-dimethylpyrrolidin-3-yl)propylidene]-2-methylpropane-2-sulfinamide?
(NE)-N-[3-(1-iodosyl-5,5-dimethylpyrrolidin-3-yl)propylidene]-2-methylpropane-2-sulfinamide has a molecular weight of 400.33 g/mol, XLogP of 3.63, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[3-(1-iodosyl-5,5-dimethylpyrrolidin-3-yl)propylidene]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 156639217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).