C28H42ClN5OS — CID 156639259
6-tert-butyl-2-chloro-N-[[6-[[4-methyl-1-(1,5,5-trimethylpyrrolidin-3-yl)pentan-3-yl]amino]-2-pyridinyl]sulfanyl]pyridine-3-carboxamide (PubChem CID 156639259) has the molecular formula C28H42ClN5OS and a molecular weight of 532.20 g/mol. Its IUPAC name is 6-tert-butyl-2-chloro-N-[[6-[[4-methyl-1-(1,5,5-trimethylpyrrolidin-3-yl)pentan-3-yl]amino]-2-pyridinyl]sulfanyl]pyridine-3-carboxamide.
| Compound Name | 6-tert-butyl-2-chloro-N-[[6-[[4-methyl-1-(1,5,5-trimethylpyrrolidin-3-yl)pentan-3-yl]amino]-2-pyridinyl]sulfanyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 156639259 |
| Molecular Formula | C28H42ClN5OS |
| Molecular Weight | 532.20 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | 6-tert-butyl-2-chloro-N-[[6-[[4-methyl-1-(1,5,5-trimethylpyrrolidin-3-yl)pentan-3-yl]amino]-2-pyridinyl]sulfanyl]pyridine-3-carboxamide |
| SMILES | CC(C)C(CCC1CN(C)C(C)(C)C1)Nc1cccc(SNC(=O)c2ccc(C(C)(C)C)nc2Cl)n1 |
| InChI | InChI=1S/C28H42ClN5OS/c1-18(2)21(14-12-19-16-28(6,7)34(8)17-19)30-23-10-9-11-24(32-23)36-33-26(35)20-13-15-22(27(3,4)5)31-25(20)29/h9-11,13,15,18-19,21H,12,14,16-17H2,1-8H3,(H,30,32)(H,33,35) |
| InChIKey | ABSXLVGWTTYJND-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.20 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|