C35H39FN6O2S — CID 156639359
8-[3-fluoro-5-(2-methylpropoxy)phenyl]-12,12-dimethyl-17-pyridin-2-yl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one (PubChem CID 156639359) has the molecular formula C35H39FN6O2S and a molecular weight of 626.80 g/mol. Its IUPAC name is 8-[3-fluoro-5-(2-methylpropoxy)phenyl]-12,12-dimethyl-17-pyridin-2-yl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one.
| Compound Name | 8-[3-fluoro-5-(2-methylpropoxy)phenyl]-12,12-dimethyl-17-pyridin-2-yl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one |
|---|---|
| PubChem CID | 156639359 |
| Molecular Formula | C35H39FN6O2S |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | 8-[3-fluoro-5-(2-methylpropoxy)phenyl]-12,12-dimethyl-17-pyridin-2-yl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one |
| SMILES | CC(C)COc1cc(F)cc(-c2ccc3c(n2)N2CC(CCC(c4ccccn4)Nc4cccc(n4)SNC3=O)CC2(C)C)c1 |
| InChI | InChI=1S/C35H39FN6O2S/c1-22(2)21-44-26-17-24(16-25(36)18-26)28-14-12-27-33(39-28)42-20-23(19-35(42,3)4)11-13-30(29-8-5-6-15-37-29)38-31-9-7-10-32(40-31)45-41-34(27)43/h5-10,12,14-18,22-23,30H,11,13,19-21H2,1-4H3,(H,38,40)(H,41,43) |
| InChIKey | FXCZDQRJISWNQH-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|