About 6-[3-(1,5-dimethyl-5-propylpyrrolidin-3-yl)propylamino]-N-methylpyridine-2-sulfinamide
6-[3-(1,5-dimethyl-5-propylpyrrolidin-3-yl)propylamino]-N-methylpyridine-2-sulfinamide (PubChem CID 156639425) has the molecular formula C18H32N4OS
and a molecular weight of 352.55 g/mol. Its IUPAC name is 6-[3-(1,5-dimethyl-5-propylpyrrolidin-3-yl)propylamino]-N-methylpyridine-2-sulfinamide.
Molecular Properties
| Compound Name | 6-[3-(1,5-dimethyl-5-propylpyrrolidin-3-yl)propylamino]-N-methylpyridine-2-sulfinamide |
| PubChem CID | 156639425 |
| Molecular Formula | C18H32N4OS |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 6-[3-(1,5-dimethyl-5-propylpyrrolidin-3-yl)propylamino]-N-methylpyridine-2-sulfinamide |
| SMILES | CCCC1(C)CC(CCCNc2cccc(S(=O)NC)n2)CN1C |
| InChI | InChI=1S/C18H32N4OS/c1-5-11-18(2)13-15(14-22(18)4)8-7-12-20-16-9-6-10-17(21-16)24(23)19-3/h6,9-10,15,19H,5,7-8,11-14H2,1-4H3,(H,20,21) |
| InChIKey | GQUHRSSROQDIQJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[3-(1,5-dimethyl-5-propylpyrrolidin-3-yl)propylamino]-N-methylpyridine-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(1,5-dimethyl-5-propylpyrrolidin-3-yl)propylamino]-N-methylpyridine-2-sulfinamide?
The IUPAC name of 6-[3-(1,5-dimethyl-5-propylpyrrolidin-3-yl)propylamino]-N-methylpyridine-2-sulfinamide (CID 156639425) is 6-[3-(1,5-dimethyl-5-propylpyrrolidin-3-yl)propylamino]-N-methylpyridine-2-sulfinamide.
What is the SMILES notation for 6-[3-(1,5-dimethyl-5-propylpyrrolidin-3-yl)propylamino]-N-methylpyridine-2-sulfinamide?
The canonical SMILES for 6-[3-(1,5-dimethyl-5-propylpyrrolidin-3-yl)propylamino]-N-methylpyridine-2-sulfinamide is CCCC1(C)CC(CCCNc2cccc(S(=O)NC)n2)CN1C.
What is the InChIKey of 6-[3-(1,5-dimethyl-5-propylpyrrolidin-3-yl)propylamino]-N-methylpyridine-2-sulfinamide?
The InChIKey is GQUHRSSROQDIQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N4OS/c1-5-11-18(2)13-15(14-22(18)4)8-7-12-20-16-9-6-10-17(21-16)24(23)19-3/h6,9-10,15,19H,5,7-8,11-14H2,1-4H3,(H,20,21).
What are the key properties of 6-[3-(1,5-dimethyl-5-propylpyrrolidin-3-yl)propylamino]-N-methylpyridine-2-sulfinamide?
6-[3-(1,5-dimethyl-5-propylpyrrolidin-3-yl)propylamino]-N-methylpyridine-2-sulfinamide has a molecular weight of 352.55 g/mol, XLogP of 3.03, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(1,5-dimethyl-5-propylpyrrolidin-3-yl)propylamino]-N-methylpyridine-2-sulfinamide is sourced from PubChem (CID 156639425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).