C31H29F4N7OS — CID 156639636
8-(6-fluoro-2-pyridinyl)-12,12-dimethyl-17-[6-(trifluoromethyl)-2-pyridinyl]-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one (PubChem CID 156639636) has the molecular formula C31H29F4N7OS and a molecular weight of 623.68 g/mol. Its IUPAC name is 8-(6-fluoro-2-pyridinyl)-12,12-dimethyl-17-[6-(trifluoromethyl)-2-pyridinyl]-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one.
| Compound Name | 8-(6-fluoro-2-pyridinyl)-12,12-dimethyl-17-[6-(trifluoromethyl)-2-pyridinyl]-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one |
|---|---|
| PubChem CID | 156639636 |
| Molecular Formula | C31H29F4N7OS |
| Molecular Weight | 623.68 g/mol |
| Exact Mass | 623.21 |
| IUPAC Name | 8-(6-fluoro-2-pyridinyl)-12,12-dimethyl-17-[6-(trifluoromethyl)-2-pyridinyl]-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one |
| SMILES | CC1(C)CC2CCC(c3cccc(C(F)(F)F)n3)Nc3cccc(n3)SNC(=O)c3ccc(-c4cccc(F)n4)nc3N1C2 |
| InChI | InChI=1S/C31H29F4N7OS/c1-30(2)16-18-12-14-22(20-6-3-8-24(36-20)31(33,34)35)38-26-10-5-11-27(40-26)44-41-29(43)19-13-15-23(39-28(19)42(30)17-18)21-7-4-9-25(32)37-21/h3-11,13,15,18,22H,12,14,16-17H2,1-2H3,(H,38,40)(H,41,43) |
| InChIKey | XDDXITBRSZIVMI-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.68 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|