C25H25F2N9O2 — CID 156640422
[4-[[2-(difluoromethyl)tetrazol-5-yl]-phenylmethyl]piperazin-1-yl]-[4-(4,5,6,7-tetrahydro-[1,3]oxazolo[4,5-c]pyridin-2-yl)-2-pyridinyl]methanone (PubChem CID 156640422) has the molecular formula C25H25F2N9O2 and a molecular weight of 521.53 g/mol. Its IUPAC name is [4-[[2-(difluoromethyl)tetrazol-5-yl]-phenylmethyl]piperazin-1-yl]-[4-(4,5,6,7-tetrahydro-[1,3]oxazolo[4,5-c]pyridin-2-yl)-2-pyridinyl]methanone.
| Compound Name | [4-[[2-(difluoromethyl)tetrazol-5-yl]-phenylmethyl]piperazin-1-yl]-[4-(4,5,6,7-tetrahydro-[1,3]oxazolo[4,5-c]pyridin-2-yl)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 156640422 |
| Molecular Formula | C25H25F2N9O2 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | [4-[[2-(difluoromethyl)tetrazol-5-yl]-phenylmethyl]piperazin-1-yl]-[4-(4,5,6,7-tetrahydro-[1,3]oxazolo[4,5-c]pyridin-2-yl)-2-pyridinyl]methanone |
| SMILES | O=C(c1cc(-c2nc3c(o2)CCNC3)ccn1)N1CCN(C(c2ccccc2)c2nnn(C(F)F)n2)CC1 |
| InChI | InChI=1S/C25H25F2N9O2/c26-25(27)36-32-22(31-33-36)21(16-4-2-1-3-5-16)34-10-12-35(13-11-34)24(37)18-14-17(6-9-29-18)23-30-19-15-28-8-7-20(19)38-23/h1-6,9,14,21,25,28H,7-8,10-13,15H2 |
| InChIKey | MSDXCGHDLAZBSU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |