C25H37N5O3 — CID 156640910
tert-butyl 4-hydroxy-3-[2-[(3,5,6-trimethylcyclohexa-1,3-dien-1-yl)amino]-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]piperidine-1-carboxylate (PubChem CID 156640910) has the molecular formula C25H37N5O3 and a molecular weight of 455.60 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-3-[2-[(3,5,6-trimethylcyclohexa-1,3-dien-1-yl)amino]-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-3-[2-[(3,5,6-trimethylcyclohexa-1,3-dien-1-yl)amino]-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 156640910 |
| Molecular Formula | C25H37N5O3 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | tert-butyl 4-hydroxy-3-[2-[(3,5,6-trimethylcyclohexa-1,3-dien-1-yl)amino]-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]piperidine-1-carboxylate |
| SMILES | CC1=CC(C)C(C)C(Nc2ncc3c(n2)CN(C2CN(C(=O)OC(C)(C)C)CCC2O)C3)=C1 |
| InChI | InChI=1S/C25H37N5O3/c1-15-9-16(2)17(3)19(10-15)27-23-26-11-18-12-30(13-20(18)28-23)21-14-29(8-7-22(21)31)24(32)33-25(4,5)6/h9-11,16-17,21-22,31H,7-8,12-14H2,1-6H3,(H,26,27,28) |
| InChIKey | OOCGVBRNCXPRSP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |