C24H35ClN4O3 — CID 156641314
N-[(3-chloro-1H-indol-5-yl)methyl]-1-methylazetidine-2-carboxamide;6-morpholin-4-ylhexanal (PubChem CID 156641314) has the molecular formula C24H35ClN4O3 and a molecular weight of 463.02 g/mol. Its IUPAC name is N-[(3-chloro-1H-indol-5-yl)methyl]-1-methylazetidine-2-carboxamide;6-morpholin-4-ylhexanal.
| Compound Name | N-[(3-chloro-1H-indol-5-yl)methyl]-1-methylazetidine-2-carboxamide;6-morpholin-4-ylhexanal |
|---|---|
| PubChem CID | 156641314 |
| Molecular Formula | C24H35ClN4O3 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | N-[(3-chloro-1H-indol-5-yl)methyl]-1-methylazetidine-2-carboxamide;6-morpholin-4-ylhexanal |
| SMILES | CN1CCC1C(=O)NCc1ccc2[nH]cc(Cl)c2c1.O=CCCCCCN1CCOCC1 |
| InChI | InChI=1S/C14H16ClN3O.C10H19NO2/c1-18-5-4-13(18)14(19)17-7-9-2-3-12-10(6-9)11(15)8-16-12;12-8-4-2-1-3-5-11-6-9-13-10-7-11/h2-3,6,8,13,16H,4-5,7H2,1H3,(H,17,19);8H,1-7,9-10H2 |
| InChIKey | BSYIZVQZCKIYQX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|