About CID 156641829
CID 156641829 (PubChem CID 156641829) has the molecular formula C7H10N3O2Po
and a molecular weight of 377.18 g/mol.
Molecular Properties
| Compound Name | CID 156641829 |
| PubChem CID | 156641829 |
| Molecular Formula | C7H10N3O2Po |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | — |
| SMILES | O=C(CC[Po])NCCc1ncno1 |
| InChI | InChI=1S/C7H10N3O2.Po/c1-2-6(11)8-4-3-7-9-5-10-12-7;/h5H,1-4H2,(H,8,11); |
| InChIKey | SIWZDOJJBYESKL-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 156641829 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156641829?
The IUPAC name of CID 156641829 (CID 156641829) is not available.
What is the SMILES notation for CID 156641829?
The canonical SMILES for CID 156641829 is O=C(CC[Po])NCCc1ncno1.
What is the InChIKey of CID 156641829?
The InChIKey is SIWZDOJJBYESKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N3O2.Po/c1-2-6(11)8-4-3-7-9-5-10-12-7;/h5H,1-4H2,(H,8,11);.
What are the key properties of CID 156641829?
CID 156641829 has a molecular weight of 377.18 g/mol, XLogP of -0.29, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156641829 is sourced from PubChem (CID 156641829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).