About CID 156641845
CID 156641845 (PubChem CID 156641845) has the molecular formula C5H7N4OPoS
and a molecular weight of 380.21 g/mol.
Molecular Properties
| Compound Name | CID 156641845 |
| PubChem CID | 156641845 |
| Molecular Formula | C5H7N4OPoS |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | — |
| SMILES | O=C(C[Po])SCCn1cnnn1 |
| InChI | InChI=1S/C5H7N4OS.Po/c1-5(10)11-3-2-9-4-6-7-8-9;/h4H,1-3H2; |
| InChIKey | BSSZKGDQOOFUNI-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze CID 156641845 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156641845?
The IUPAC name of CID 156641845 (CID 156641845) is not available.
What is the SMILES notation for CID 156641845?
The canonical SMILES for CID 156641845 is O=C(C[Po])SCCn1cnnn1.
What is the InChIKey of CID 156641845?
The InChIKey is BSSZKGDQOOFUNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N4OS.Po/c1-5(10)11-3-2-9-4-6-7-8-9;/h4H,1-3H2;.
What are the key properties of CID 156641845?
CID 156641845 has a molecular weight of 380.21 g/mol, XLogP of -0.48, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156641845 is sourced from PubChem (CID 156641845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).