C16H8Cl3N3O3 — CID 15664190
2-[3,5-dichloro-4-(4-chlorobenzoyl)phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 15664190) has the molecular formula C16H8Cl3N3O3 and a molecular weight of 396.62 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-(4-chlorobenzoyl)phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[3,5-dichloro-4-(4-chlorobenzoyl)phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 15664190 |
| Molecular Formula | C16H8Cl3N3O3 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 394.96 |
| IUPAC Name | 2-[3,5-dichloro-4-(4-chlorobenzoyl)phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | O=C(c1ccc(Cl)cc1)c1c(Cl)cc(-n2ncc(=O)[nH]c2=O)cc1Cl |
| InChI | InChI=1S/C16H8Cl3N3O3/c17-9-3-1-8(2-4-9)15(24)14-11(18)5-10(6-12(14)19)22-16(25)21-13(23)7-20-22/h1-7H,(H,21,23,25) |
| InChIKey | WWMSVMFCIRAZNT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |