About CID 156641921
CID 156641921 (PubChem CID 156641921) has the molecular formula C6H8N3O2Po
and a molecular weight of 363.15 g/mol.
Molecular Properties
| Compound Name | CID 156641921 |
| PubChem CID | 156641921 |
| Molecular Formula | C6H8N3O2Po |
| Molecular Weight | 363.15 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | — |
| SMILES | O=C(C[Po])NCCc1ncno1 |
| InChI | InChI=1S/C6H8N3O2.Po/c1-5(10)7-3-2-6-8-4-9-11-6;/h4H,1-3H2,(H,7,10); |
| InChIKey | JUWUXAITFKKIDF-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.15 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 156641921 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156641921?
The IUPAC name of CID 156641921 (CID 156641921) is not available.
What is the SMILES notation for CID 156641921?
The canonical SMILES for CID 156641921 is O=C(C[Po])NCCc1ncno1.
What is the InChIKey of CID 156641921?
The InChIKey is JUWUXAITFKKIDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N3O2.Po/c1-5(10)7-3-2-6-8-4-9-11-6;/h4H,1-3H2,(H,7,10);.
What are the key properties of CID 156641921?
CID 156641921 has a molecular weight of 363.15 g/mol, XLogP of -0.68, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156641921 is sourced from PubChem (CID 156641921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).