C12H13NO2 — CID 15664197
5-(2,5-dihydropyrrol-1-yl)-2,3-dimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 15664197) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 5-(2,5-dihydropyrrol-1-yl)-2,3-dimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 5-(2,5-dihydropyrrol-1-yl)-2,3-dimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 15664197 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 5-(2,5-dihydropyrrol-1-yl)-2,3-dimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(N2CC=CC2)=CC1=O |
| InChI | InChI=1S/C12H13NO2/c1-8-9(2)12(15)10(7-11(8)14)13-5-3-4-6-13/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | NIGRNMMNETWVNU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|