About N-methyl-N'-[2-(4-piperazin-1-ylphenyl)quinolin-4-yl]propane-1,3-diamine
N-methyl-N'-[2-(4-piperazin-1-ylphenyl)quinolin-4-yl]propane-1,3-diamine (PubChem CID 156642138) has the molecular formula C23H29N5
and a molecular weight of 375.52 g/mol. Its IUPAC name is N-methyl-N'-[2-(4-piperazin-1-ylphenyl)quinolin-4-yl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N-methyl-N'-[2-(4-piperazin-1-ylphenyl)quinolin-4-yl]propane-1,3-diamine |
| PubChem CID | 156642138 |
| Molecular Formula | C23H29N5 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | N-methyl-N'-[2-(4-piperazin-1-ylphenyl)quinolin-4-yl]propane-1,3-diamine |
| SMILES | CNCCCNc1cc(-c2ccc(N3CCNCC3)cc2)nc2ccccc12 |
| InChI | InChI=1S/C23H29N5/c1-24-11-4-12-26-23-17-22(27-21-6-3-2-5-20(21)23)18-7-9-19(10-8-18)28-15-13-25-14-16-28/h2-3,5-10,17,24-25H,4,11-16H2,1H3,(H,26,27) |
| InChIKey | JOELBEKPKSRDDL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N'-[2-(4-piperazin-1-ylphenyl)quinolin-4-yl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N'-[2-(4-piperazin-1-ylphenyl)quinolin-4-yl]propane-1,3-diamine?
The IUPAC name of N-methyl-N'-[2-(4-piperazin-1-ylphenyl)quinolin-4-yl]propane-1,3-diamine (CID 156642138) is N-methyl-N'-[2-(4-piperazin-1-ylphenyl)quinolin-4-yl]propane-1,3-diamine.
What is the SMILES notation for N-methyl-N'-[2-(4-piperazin-1-ylphenyl)quinolin-4-yl]propane-1,3-diamine?
The canonical SMILES for N-methyl-N'-[2-(4-piperazin-1-ylphenyl)quinolin-4-yl]propane-1,3-diamine is CNCCCNc1cc(-c2ccc(N3CCNCC3)cc2)nc2ccccc12.
What is the InChIKey of N-methyl-N'-[2-(4-piperazin-1-ylphenyl)quinolin-4-yl]propane-1,3-diamine?
The InChIKey is JOELBEKPKSRDDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29N5/c1-24-11-4-12-26-23-17-22(27-21-6-3-2-5-20(21)23)18-7-9-19(10-8-18)28-15-13-25-14-16-28/h2-3,5-10,17,24-25H,4,11-16H2,1H3,(H,26,27).
What are the key properties of N-methyl-N'-[2-(4-piperazin-1-ylphenyl)quinolin-4-yl]propane-1,3-diamine?
N-methyl-N'-[2-(4-piperazin-1-ylphenyl)quinolin-4-yl]propane-1,3-diamine has a molecular weight of 375.52 g/mol, XLogP of 3.33, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N'-[2-(4-piperazin-1-ylphenyl)quinolin-4-yl]propane-1,3-diamine is sourced from PubChem (CID 156642138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).