C16H16N4O3S — CID 156642235
4-[3-(2-piperidin-4-ylsulfanylethynyl)phenoxy]-1H-triazole-5-carboxylic acid (PubChem CID 156642235) has the molecular formula C16H16N4O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is 4-[3-(2-piperidin-4-ylsulfanylethynyl)phenoxy]-1H-triazole-5-carboxylic acid.
| Compound Name | 4-[3-(2-piperidin-4-ylsulfanylethynyl)phenoxy]-1H-triazole-5-carboxylic acid |
|---|---|
| PubChem CID | 156642235 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 4-[3-(2-piperidin-4-ylsulfanylethynyl)phenoxy]-1H-triazole-5-carboxylic acid |
| SMILES | O=C(O)c1[nH]nnc1Oc1cccc(C#CSC2CCNCC2)c1 |
| InChI | InChI=1S/C16H16N4O3S/c21-16(22)14-15(19-20-18-14)23-12-3-1-2-11(10-12)6-9-24-13-4-7-17-8-5-13/h1-3,10,13,17H,4-5,7-8H2,(H,21,22)(H,18,19,20) |
| InChIKey | PHSVHAFQONWAMW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|