C32H48N5O4PS — CID 156642287
[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[2-[9-[4-(3,3-dimethylbut-1-ynyl)phenyl]nonylsulfanyl]ethoxy]phosphinic acid (PubChem CID 156642287) has the molecular formula C32H48N5O4PS and a molecular weight of 629.81 g/mol. Its IUPAC name is [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[2-[9-[4-(3,3-dimethylbut-1-ynyl)phenyl]nonylsulfanyl]ethoxy]phosphinic acid.
| Compound Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[2-[9-[4-(3,3-dimethylbut-1-ynyl)phenyl]nonylsulfanyl]ethoxy]phosphinic acid |
|---|---|
| PubChem CID | 156642287 |
| Molecular Formula | C32H48N5O4PS |
| Molecular Weight | 629.81 g/mol |
| Exact Mass | 629.32 |
| IUPAC Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[2-[9-[4-(3,3-dimethylbut-1-ynyl)phenyl]nonylsulfanyl]ethoxy]phosphinic acid |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)(O)OCCSCCCCCCCCCc1ccc(C#CC(C)(C)C)cc1 |
| InChI | InChI=1S/C32H48N5O4PS/c1-26(22-37-24-36-29-30(33)34-23-35-31(29)37)40-25-42(38,39)41-19-21-43-20-11-9-7-5-6-8-10-12-27-13-15-28(16-14-27)17-18-32(2,3)4/h13-16,23-24,26H,5-12,19-22,25H2,1-4H3,(H,38,39)(H2,33,34,35)/t26-/m1/s1 |
| InChIKey | ZPQLAIXNBOZNKK-AREMUKBSSA-N |
| XLogP | 7.08 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.81 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|