C39H33N3O2 — CID 156643047
(2E)-2-[5-[7-[2,5-bis[(1Z)-buta-1,3-dienyl]-3,4-dimethylpyrrol-1-yl]dibenzofuran-1-yl]-2-methylidene-1-benzofuran-3-ylidene]but-3-enimidamide (PubChem CID 156643047) has the molecular formula C39H33N3O2 and a molecular weight of 575.71 g/mol. Its IUPAC name is (2E)-2-[5-[7-[2,5-bis[(1Z)-buta-1,3-dienyl]-3,4-dimethylpyrrol-1-yl]dibenzofuran-1-yl]-2-methylidene-1-benzofuran-3-ylidene]but-3-enimidamide.
| Compound Name | (2E)-2-[5-[7-[2,5-bis[(1Z)-buta-1,3-dienyl]-3,4-dimethylpyrrol-1-yl]dibenzofuran-1-yl]-2-methylidene-1-benzofuran-3-ylidene]but-3-enimidamide |
|---|---|
| PubChem CID | 156643047 |
| Molecular Formula | C39H33N3O2 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | (2E)-2-[5-[7-[2,5-bis[(1Z)-buta-1,3-dienyl]-3,4-dimethylpyrrol-1-yl]dibenzofuran-1-yl]-2-methylidene-1-benzofuran-3-ylidene]but-3-enimidamide |
| SMILES | [H]/N=C(N)/C(C=C)=c1/c(=C)oc2ccc(-c3cccc4oc5cc(-n6c(/C=C\C=C)c(C)c(C)c6/C=C\C=C)ccc5c34)cc12 |
| InChI | InChI=1S/C39H33N3O2/c1-7-10-14-32-23(4)24(5)33(15-11-8-2)42(32)27-18-19-30-36(22-27)44-35-16-12-13-29(38(30)35)26-17-20-34-31(21-26)37(25(6)43-34)28(9-3)39(40)41/h7-22H,1-3,6H2,4-5H3,(H3,40,41)/b14-10-,15-11-,37-28- |
| InChIKey | XHWIRFHOGIQEAT-SKUVSJATSA-N |
| XLogP | 8.49 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|