C63H43N5OS — CID 156643151
N'-[N-[[8-(6-carbazol-9-yldibenzothiophen-1-yl)dibenzofuran-1-yl]methyl]-C-[(3E)-hexa-1,3,5-trien-3-yl]carbonimidoyl]-9-phenylcarbazole-3-carboximidamide (PubChem CID 156643151) has the molecular formula C63H43N5OS and a molecular weight of 918.14 g/mol. Its IUPAC name is N'-[N-[[8-(6-carbazol-9-yldibenzothiophen-1-yl)dibenzofuran-1-yl]methyl]-C-[(3E)-hexa-1,3,5-trien-3-yl]carbonimidoyl]-9-phenylcarbazole-3-carboximidamide.
| Compound Name | N'-[N-[[8-(6-carbazol-9-yldibenzothiophen-1-yl)dibenzofuran-1-yl]methyl]-C-[(3E)-hexa-1,3,5-trien-3-yl]carbonimidoyl]-9-phenylcarbazole-3-carboximidamide |
|---|---|
| PubChem CID | 156643151 |
| Molecular Formula | C63H43N5OS |
| Molecular Weight | 918.14 g/mol |
| Exact Mass | 917.32 |
| IUPAC Name | N'-[N-[[8-(6-carbazol-9-yldibenzothiophen-1-yl)dibenzofuran-1-yl]methyl]-C-[(3E)-hexa-1,3,5-trien-3-yl]carbonimidoyl]-9-phenylcarbazole-3-carboximidamide |
| SMILES | C=C/C=C(C=C)/C(=N/Cc1cccc2oc3ccc(-c4cccc5sc6c(-n7c8ccccc8c8ccccc87)cccc6c45)cc3c12)/N=C(\N)c1ccc2c(c1)c1ccccc1n2-c1ccccc1 |
| InChI | InChI=1S/C63H43N5OS/c1-3-17-39(4-2)63(66-62(64)41-32-34-54-49(37-41)47-23-10-11-26-51(47)67(54)43-19-6-5-7-20-43)65-38-42-18-14-30-57-59(42)50-36-40(33-35-56(50)69-57)44-24-16-31-58-60(44)48-25-15-29-55(61(48)70-58)68-52-27-12-8-21-45(52)46-22-9-13-28-53(46)68/h3-37H,1-2,38H2,(H2,64,65,66)/b39-17+ |
| InChIKey | UKSQUYPVGWFXFO-HZTVMEOHSA-N |
| XLogP | 16.42 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.14 |
| LogP ≤ 5 | 16.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|