About 2-aminophenol;pyridine-2,3,6-triamine
2-aminophenol;pyridine-2,3,6-triamine (PubChem CID 156643993) has the molecular formula C11H15N5O
and a molecular weight of 233.28 g/mol. Its IUPAC name is 2-aminophenol;pyridine-2,3,6-triamine.
Molecular Properties
| Compound Name | 2-aminophenol;pyridine-2,3,6-triamine |
| PubChem CID | 156643993 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 2-aminophenol;pyridine-2,3,6-triamine |
| SMILES | Nc1ccc(N)c(N)n1.Nc1ccccc1O |
| InChI | InChI=1S/C6H7NO.C5H8N4/c7-5-3-1-2-4-6(5)8;6-3-1-2-4(7)9-5(3)8/h1-4,8H,7H2;1-2H,6H2,(H4,7,8,9) |
| InChIKey | HWRCLWIFNZVUCZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-aminophenol;pyridine-2,3,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminophenol;pyridine-2,3,6-triamine?
The IUPAC name of 2-aminophenol;pyridine-2,3,6-triamine (CID 156643993) is 2-aminophenol;pyridine-2,3,6-triamine.
What is the SMILES notation for 2-aminophenol;pyridine-2,3,6-triamine?
The canonical SMILES for 2-aminophenol;pyridine-2,3,6-triamine is Nc1ccc(N)c(N)n1.Nc1ccccc1O.
What is the InChIKey of 2-aminophenol;pyridine-2,3,6-triamine?
The InChIKey is HWRCLWIFNZVUCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO.C5H8N4/c7-5-3-1-2-4-6(5)8;6-3-1-2-4(7)9-5(3)8/h1-4,8H,7H2;1-2H,6H2,(H4,7,8,9).
What are the key properties of 2-aminophenol;pyridine-2,3,6-triamine?
2-aminophenol;pyridine-2,3,6-triamine has a molecular weight of 233.28 g/mol, XLogP of 0.80, 0 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminophenol;pyridine-2,3,6-triamine is sourced from PubChem (CID 156643993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).