C27H32F2N4OSi — CID 156644983
1-[(1S,3R)-1-(4-aminophenyl)-3-(butylamino)-6,8-difluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-trimethylsilylprop-2-yn-1-one (PubChem CID 156644983) has the molecular formula C27H32F2N4OSi and a molecular weight of 494.66 g/mol. Its IUPAC name is 1-[(1S,3R)-1-(4-aminophenyl)-3-(butylamino)-6,8-difluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-trimethylsilylprop-2-yn-1-one.
| Compound Name | 1-[(1S,3R)-1-(4-aminophenyl)-3-(butylamino)-6,8-difluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-trimethylsilylprop-2-yn-1-one |
|---|---|
| PubChem CID | 156644983 |
| Molecular Formula | C27H32F2N4OSi |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 1-[(1S,3R)-1-(4-aminophenyl)-3-(butylamino)-6,8-difluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-trimethylsilylprop-2-yn-1-one |
| SMILES | CCCCN[C@H]1Cc2c([nH]c3c(F)cc(F)cc23)[C@H](c2ccc(N)cc2)N1C(=O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C27H32F2N4OSi/c1-5-6-12-31-23-16-21-20-14-18(28)15-22(29)25(20)32-26(21)27(17-7-9-19(30)10-8-17)33(23)24(34)11-13-35(2,3)4/h7-10,14-15,23,27,31-32H,5-6,12,16,30H2,1-4H3/t23-,27+/m1/s1 |
| InChIKey | OKVNHHBMAUHYHI-KCWPFWIISA-N |
| XLogP | 5.10 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|