C11H17NS — CID 156645134
4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylpent-4-en-1-amine (PubChem CID 156645134) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is 4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylpent-4-en-1-amine.
| Compound Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylpent-4-en-1-amine |
|---|---|
| PubChem CID | 156645134 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylpent-4-en-1-amine |
| SMILES | C=C/C=C(\C=C)SC(=C)CCCN |
| InChI | InChI=1S/C11H17NS/c1-4-7-11(5-2)13-10(3)8-6-9-12/h4-5,7H,1-3,6,8-9,12H2/b11-7+ |
| InChIKey | IXLJBWMSHQKFSR-YRNVUSSQSA-N |
| XLogP | 3.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|