About ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbutan-1-amine;molecular hydrogen
ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbutan-1-amine;molecular hydrogen (PubChem CID 156645135) has the molecular formula C12H25NS
and a molecular weight of 215.41 g/mol. Its IUPAC name is ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbutan-1-amine;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbutan-1-amine;molecular hydrogen |
| PubChem CID | 156645135 |
| Molecular Formula | C12H25NS |
| Molecular Weight | 215.41 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbutan-1-amine;molecular hydrogen |
| SMILES | C=C/C=C(\C=C)SCCCCN.CC.[H][H] |
| InChI | InChI=1S/C10H17NS.C2H6.H2/c1-3-7-10(4-2)12-9-6-5-8-11;1-2;/h3-4,7H,1-2,5-6,8-9,11H2;1-2H3;1H/b10-7+;; |
| InChIKey | QKCVBQHCFMIVKT-WRQJSNHTSA-N |
| XLogP | 3.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbutan-1-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbutan-1-amine;molecular hydrogen?
The IUPAC name of ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbutan-1-amine;molecular hydrogen (CID 156645135) is ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbutan-1-amine;molecular hydrogen.
What is the SMILES notation for ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbutan-1-amine;molecular hydrogen?
The canonical SMILES for ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbutan-1-amine;molecular hydrogen is C=C/C=C(\C=C)SCCCCN.CC.[H][H].
What is the InChIKey of ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbutan-1-amine;molecular hydrogen?
The InChIKey is QKCVBQHCFMIVKT-WRQJSNHTSA-N. The full InChI is InChI=1S/C10H17NS.C2H6.H2/c1-3-7-10(4-2)12-9-6-5-8-11;1-2;/h3-4,7H,1-2,5-6,8-9,11H2;1-2H3;1H/b10-7+;;.
What are the key properties of ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbutan-1-amine;molecular hydrogen?
ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbutan-1-amine;molecular hydrogen has a molecular weight of 215.41 g/mol, XLogP of 3.99, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbutan-1-amine;molecular hydrogen is sourced from PubChem (CID 156645135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).