C16H33NS — CID 156645137
butane;N-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbutan-1-amine;molecular hydrogen (PubChem CID 156645137) has the molecular formula C16H33NS and a molecular weight of 271.51 g/mol. Its IUPAC name is butane;N-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbutan-1-amine;molecular hydrogen.
| Compound Name | butane;N-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbutan-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 156645137 |
| Molecular Formula | C16H33NS |
| Molecular Weight | 271.51 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | butane;N-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbutan-1-amine;molecular hydrogen |
| SMILES | C=C/C=C(\C=C)SCCCCNCC.CCCC.[H][H] |
| InChI | InChI=1S/C12H21NS.C4H10.H2/c1-4-9-12(5-2)14-11-8-7-10-13-6-3;1-3-4-2;/h4-5,9,13H,1-2,6-8,10-11H2,3H3;3-4H2,1-2H3;1H/b12-9+;; |
| InChIKey | HYRLIGQKFJYPCR-ANOGCNOSSA-N |
| XLogP | 5.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|