C24H28ClFN6O — CID 156645196
4-[(5R)-4-[2-amino-1-(4-fluorophenyl)prop-2-enyl]-2,5-diethylpiperazin-1-yl]-6-chloro-1H-pyrido[3,2-d]pyrimidin-2-one (PubChem CID 156645196) has the molecular formula C24H28ClFN6O and a molecular weight of 470.98 g/mol. Its IUPAC name is 4-[(5R)-4-[2-amino-1-(4-fluorophenyl)prop-2-enyl]-2,5-diethylpiperazin-1-yl]-6-chloro-1H-pyrido[3,2-d]pyrimidin-2-one.
| Compound Name | 4-[(5R)-4-[2-amino-1-(4-fluorophenyl)prop-2-enyl]-2,5-diethylpiperazin-1-yl]-6-chloro-1H-pyrido[3,2-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 156645196 |
| Molecular Formula | C24H28ClFN6O |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 4-[(5R)-4-[2-amino-1-(4-fluorophenyl)prop-2-enyl]-2,5-diethylpiperazin-1-yl]-6-chloro-1H-pyrido[3,2-d]pyrimidin-2-one |
| SMILES | C=C(N)C(c1ccc(F)cc1)N1CC(CC)N(c2nc(=O)[nH]c3ccc(Cl)nc23)C[C@H]1CC |
| InChI | InChI=1S/C24H28ClFN6O/c1-4-17-13-32(23-21-19(28-24(33)30-23)10-11-20(25)29-21)18(5-2)12-31(17)22(14(3)27)15-6-8-16(26)9-7-15/h6-11,17-18,22H,3-5,12-13,27H2,1-2H3,(H,28,30,33)/t17-,18?,22?/m1/s1 |
| InChIKey | WNYUZQFUNHHVMD-PDDLGQBUSA-N |
| XLogP | 4.00 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|