C14H21FO — CID 156645255
1-(2,4-dimethylpentan-3-yl)-4-fluoro-2-methoxybenzene (PubChem CID 156645255) has the molecular formula C14H21FO and a molecular weight of 224.32 g/mol. Its IUPAC name is 1-(2,4-dimethylpentan-3-yl)-4-fluoro-2-methoxybenzene.
| Compound Name | 1-(2,4-dimethylpentan-3-yl)-4-fluoro-2-methoxybenzene |
|---|---|
| PubChem CID | 156645255 |
| Molecular Formula | C14H21FO |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 1-(2,4-dimethylpentan-3-yl)-4-fluoro-2-methoxybenzene |
| SMILES | COc1cc(F)ccc1C(C(C)C)C(C)C |
| InChI | InChI=1S/C14H21FO/c1-9(2)14(10(3)4)12-7-6-11(15)8-13(12)16-5/h6-10,14H,1-5H3 |
| InChIKey | AWDWADOFDNJJFE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |