C16H24ClN5O — CID 156645324
6-chloro-4-(2-ethylpiperazin-1-yl)-1-methylpyrido[3,2-d]pyrimidin-2-one;ethane (PubChem CID 156645324) has the molecular formula C16H24ClN5O and a molecular weight of 337.86 g/mol. Its IUPAC name is 6-chloro-4-(2-ethylpiperazin-1-yl)-1-methylpyrido[3,2-d]pyrimidin-2-one;ethane.
| Compound Name | 6-chloro-4-(2-ethylpiperazin-1-yl)-1-methylpyrido[3,2-d]pyrimidin-2-one;ethane |
|---|---|
| PubChem CID | 156645324 |
| Molecular Formula | C16H24ClN5O |
| Molecular Weight | 337.86 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 6-chloro-4-(2-ethylpiperazin-1-yl)-1-methylpyrido[3,2-d]pyrimidin-2-one;ethane |
| SMILES | CC.CCC1CNCCN1c1nc(=O)n(C)c2ccc(Cl)nc12 |
| InChI | InChI=1S/C14H18ClN5O.C2H6/c1-3-9-8-16-6-7-20(9)13-12-10(4-5-11(15)17-12)19(2)14(21)18-13;1-2/h4-5,9,16H,3,6-8H2,1-2H3;1-2H3 |
| InChIKey | YEZSDZISKQTAKI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.86 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|