C24H30FNO2Si — CID 156645484
8-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-fluoro-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 156645484) has the molecular formula C24H30FNO2Si and a molecular weight of 411.59 g/mol. Its IUPAC name is 8-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-fluoro-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | 8-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-fluoro-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 156645484 |
| Molecular Formula | C24H30FNO2Si |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 8-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-fluoro-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | CC(C)(C)[Si](OCC12CCC(=O)N1CC(F)C2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H30FNO2Si/c1-23(2,3)29(20-10-6-4-7-11-20,21-12-8-5-9-13-21)28-18-24-15-14-22(27)26(24)17-19(25)16-24/h4-13,19H,14-18H2,1-3H3 |
| InChIKey | ZTOQFDGZRAQJCK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|