C26H35NO2Si — CID 156645518
8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,5,6,7-tetrahydropyrrolizin-3-one (PubChem CID 156645518) has the molecular formula C26H35NO2Si and a molecular weight of 421.66 g/mol. Its IUPAC name is 8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,5,6,7-tetrahydropyrrolizin-3-one.
| Compound Name | 8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,5,6,7-tetrahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 156645518 |
| Molecular Formula | C26H35NO2Si |
| Molecular Weight | 421.66 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,5,6,7-tetrahydropyrrolizin-3-one |
| SMILES | CC1(C)CC2(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CCCN2C1=O |
| InChI | InChI=1S/C26H35NO2Si/c1-24(2,3)30(21-13-8-6-9-14-21,22-15-10-7-11-16-22)29-20-26-17-12-18-27(26)23(28)25(4,5)19-26/h6-11,13-16H,12,17-20H2,1-5H3 |
| InChIKey | FBNIKEMIVVVETQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|