C21H28ClFN6O — CID 156645713
7-chloro-4-(3,5-dimethylpiperazin-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine (PubChem CID 156645713) has the molecular formula C21H28ClFN6O and a molecular weight of 434.95 g/mol. Its IUPAC name is 7-chloro-4-(3,5-dimethylpiperazin-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine.
| Compound Name | 7-chloro-4-(3,5-dimethylpiperazin-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 156645713 |
| Molecular Formula | C21H28ClFN6O |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 7-chloro-4-(3,5-dimethylpiperazin-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
| SMILES | CC1CN(c2nc(OCC34CCCN3CCC4)nc3c(F)c(Cl)ncc23)CC(C)N1 |
| InChI | InChI=1S/C21H28ClFN6O/c1-13-10-28(11-14(2)25-13)19-15-9-24-18(22)16(23)17(15)26-20(27-19)30-12-21-5-3-7-29(21)8-4-6-21/h9,13-14,25H,3-8,10-12H2,1-2H3 |
| InChIKey | HLCCFYNFCHSRKP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|