C17H16BFO2PS2Tl — CID 156645774
(10-fluoro-4,4,5-trimethyl-3,18-dioxa-6-phospha-2-boratetracyclo[7.7.1.12,5.013,17]octadeca-1(17),9,11,13,15-pentaen-7-yn-6-yl)sulfanylthallium;sulfane (PubChem CID 156645774) has the molecular formula C17H16BFO2PS2Tl and a molecular weight of 581.61 g/mol. Its IUPAC name is (10-fluoro-4,4,5-trimethyl-3,18-dioxa-6-phospha-2-boratetracyclo[7.7.1.12,5.013,17]octadeca-1(17),9,11,13,15-pentaen-7-yn-6-yl)sulfanylthallium;sulfane.
| Compound Name | (10-fluoro-4,4,5-trimethyl-3,18-dioxa-6-phospha-2-boratetracyclo[7.7.1.12,5.013,17]octadeca-1(17),9,11,13,15-pentaen-7-yn-6-yl)sulfanylthallium;sulfane |
|---|---|
| PubChem CID | 156645774 |
| Molecular Formula | C17H16BFO2PS2Tl |
| Molecular Weight | 581.61 g/mol |
| Exact Mass | 582.02 |
| IUPAC Name | (10-fluoro-4,4,5-trimethyl-3,18-dioxa-6-phospha-2-boratetracyclo[7.7.1.12,5.013,17]octadeca-1(17),9,11,13,15-pentaen-7-yn-6-yl)sulfanylthallium;sulfane |
| SMILES | CC1(C)OB2OC1(C)P(S[Tl])C#Cc1c(F)ccc3cccc2c13.S |
| InChI | InChI=1S/C17H14BFO2PS.H2S.Tl/c1-16(2)17(3)21-18(20-16)13-6-4-5-11-7-8-14(19)12(15(11)13)9-10-22(17)23;;/h4-8H,1-3H3;1H2;/q-1;;+1 |
| InChIKey | WCIYPRZCGZKRPY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|