C28H35FN6O — CID 156645888
1-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-(fluoromethyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimidin-5-yl]-N-(1-phenylethenyl)methanimine (PubChem CID 156645888) has the molecular formula C28H35FN6O and a molecular weight of 490.63 g/mol. Its IUPAC name is 1-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-(fluoromethyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimidin-5-yl]-N-(1-phenylethenyl)methanimine.
| Compound Name | 1-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-(fluoromethyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimidin-5-yl]-N-(1-phenylethenyl)methanimine |
|---|---|
| PubChem CID | 156645888 |
| Molecular Formula | C28H35FN6O |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 1-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-(fluoromethyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimidin-5-yl]-N-(1-phenylethenyl)methanimine |
| SMILES | C=C(/N=C/c1c(CF)nc(OCC23CCCN2CCC3)nc1N1CC2CCC(C1)N2)c1ccccc1 |
| InChI | InChI=1S/C28H35FN6O/c1-20(21-7-3-2-4-8-21)30-16-24-25(15-29)32-27(36-19-28-11-5-13-35(28)14-6-12-28)33-26(24)34-17-22-9-10-23(18-34)31-22/h2-4,7-8,16,22-23,31H,1,5-6,9-15,17-19H2/b30-16+ |
| InChIKey | AYINDEADFNLBCN-OKCVXOCRSA-N |
| XLogP | 3.98 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|