C9H3Cl2F7N2O — CID 156646269
N-(3,5-dichloro-4-pyridinyl)-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 156646269) has the molecular formula C9H3Cl2F7N2O and a molecular weight of 359.03 g/mol. Its IUPAC name is N-(3,5-dichloro-4-pyridinyl)-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-(3,5-dichloro-4-pyridinyl)-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 156646269 |
| Molecular Formula | C9H3Cl2F7N2O |
| Molecular Weight | 359.03 g/mol |
| Exact Mass | 357.95 |
| IUPAC Name | N-(3,5-dichloro-4-pyridinyl)-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | O=C(Nc1c(Cl)cncc1Cl)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H3Cl2F7N2O/c10-3-1-19-2-4(11)5(3)20-6(21)7(12,13)8(14,15)9(16,17)18/h1-2H,(H,19,20,21) |
| InChIKey | JXCMQUYTJYFHCL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.03 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|