C23H25F2N5O5 — CID 156646415
N-[4-[(4Z,8E)-7-amino-8-methyl-2-(trihydroxymethyl)-2,3-dihydro-1H-1,3,6-triazonin-9-yl]-3-methylphenyl]-2-(3,5-difluorophenyl)-2-hydroxyacetamide (PubChem CID 156646415) has the molecular formula C23H25F2N5O5 and a molecular weight of 489.48 g/mol. Its IUPAC name is N-[4-[(4Z,8E)-7-amino-8-methyl-2-(trihydroxymethyl)-2,3-dihydro-1H-1,3,6-triazonin-9-yl]-3-methylphenyl]-2-(3,5-difluorophenyl)-2-hydroxyacetamide.
| Compound Name | N-[4-[(4Z,8E)-7-amino-8-methyl-2-(trihydroxymethyl)-2,3-dihydro-1H-1,3,6-triazonin-9-yl]-3-methylphenyl]-2-(3,5-difluorophenyl)-2-hydroxyacetamide |
|---|---|
| PubChem CID | 156646415 |
| Molecular Formula | C23H25F2N5O5 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | N-[4-[(4Z,8E)-7-amino-8-methyl-2-(trihydroxymethyl)-2,3-dihydro-1H-1,3,6-triazonin-9-yl]-3-methylphenyl]-2-(3,5-difluorophenyl)-2-hydroxyacetamide |
| SMILES | CC1=C(/c2ccc(NC(=O)C(O)c3cc(F)cc(F)c3)cc2C)NC(C(O)(O)O)N/C=C/N=C\1N |
| InChI | InChI=1S/C23H25F2N5O5/c1-11-7-16(29-21(32)19(31)13-8-14(24)10-15(25)9-13)3-4-17(11)18-12(2)20(26)27-5-6-28-22(30-18)23(33,34)35/h3-10,19,22,28,30-31,33-35H,1-2H3,(H2,26,27)(H,29,32)/b6-5+,18-12+ |
| InChIKey | BZMNLMMYDYGWRI-YADWXFRQSA-N |
| XLogP | 0.65 |
| TPSA | 172.46 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|