About (5-chlorocyclohexa-1,5-dien-1-yl)methanol
(5-chlorocyclohexa-1,5-dien-1-yl)methanol (PubChem CID 156646713) has the molecular formula C7H9ClO
and a molecular weight of 144.60 g/mol. Its IUPAC name is (5-chlorocyclohexa-1,5-dien-1-yl)methanol.
Molecular Properties
| Compound Name | (5-chlorocyclohexa-1,5-dien-1-yl)methanol |
| PubChem CID | 156646713 |
| Molecular Formula | C7H9ClO |
| Molecular Weight | 144.60 g/mol |
| Exact Mass | 144.03 |
| IUPAC Name | (5-chlorocyclohexa-1,5-dien-1-yl)methanol |
| SMILES | OCC1=CCCC(Cl)=C1 |
| InChI | InChI=1S/C7H9ClO/c8-7-3-1-2-6(4-7)5-9/h2,4,9H,1,3,5H2 |
| InChIKey | BLCNQEOXRVBADX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.60 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5-chlorocyclohexa-1,5-dien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chlorocyclohexa-1,5-dien-1-yl)methanol?
The IUPAC name of (5-chlorocyclohexa-1,5-dien-1-yl)methanol (CID 156646713) is (5-chlorocyclohexa-1,5-dien-1-yl)methanol.
What is the SMILES notation for (5-chlorocyclohexa-1,5-dien-1-yl)methanol?
The canonical SMILES for (5-chlorocyclohexa-1,5-dien-1-yl)methanol is OCC1=CCCC(Cl)=C1.
What is the InChIKey of (5-chlorocyclohexa-1,5-dien-1-yl)methanol?
The InChIKey is BLCNQEOXRVBADX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClO/c8-7-3-1-2-6(4-7)5-9/h2,4,9H,1,3,5H2.
What are the key properties of (5-chlorocyclohexa-1,5-dien-1-yl)methanol?
(5-chlorocyclohexa-1,5-dien-1-yl)methanol has a molecular weight of 144.60 g/mol, XLogP of 1.82, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chlorocyclohexa-1,5-dien-1-yl)methanol is sourced from PubChem (CID 156646713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).