About tert-butyliodanium;tetraphenylboranuide
tert-butyliodanium;tetraphenylboranuide (PubChem CID 156646741) has the molecular formula C28H30BI
and a molecular weight of 504.26 g/mol. Its IUPAC name is tert-butyliodanium;tetraphenylboranuide.
Molecular Properties
| Compound Name | tert-butyliodanium;tetraphenylboranuide |
| PubChem CID | 156646741 |
| Molecular Formula | C28H30BI |
| Molecular Weight | 504.26 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | tert-butyliodanium;tetraphenylboranuide |
| SMILES | CC(C)(C)[IH+].c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C4H10I/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-4(2,3)5/h1-20H;5H,1-3H3/q-1;+1 |
| InChIKey | XGVISGKOUZKZKY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 504.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyliodanium;tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyliodanium;tetraphenylboranuide?
The IUPAC name of tert-butyliodanium;tetraphenylboranuide (CID 156646741) is tert-butyliodanium;tetraphenylboranuide.
What is the SMILES notation for tert-butyliodanium;tetraphenylboranuide?
The canonical SMILES for tert-butyliodanium;tetraphenylboranuide is CC(C)(C)[IH+].c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of tert-butyliodanium;tetraphenylboranuide?
The InChIKey is XGVISGKOUZKZKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20B.C4H10I/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-4(2,3)5/h1-20H;5H,1-3H3/q-1;+1.
What are the key properties of tert-butyliodanium;tetraphenylboranuide?
tert-butyliodanium;tetraphenylboranuide has a molecular weight of 504.26 g/mol, XLogP of 1.13, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyliodanium;tetraphenylboranuide is sourced from PubChem (CID 156646741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).