About (3R)-3-aminononan-2-one;butan-2-imine
(3R)-3-aminononan-2-one;butan-2-imine (PubChem CID 156646754) has the molecular formula C13H28N2O
and a molecular weight of 228.38 g/mol. Its IUPAC name is (3R)-3-aminononan-2-one;butan-2-imine.
Molecular Properties
| Compound Name | (3R)-3-aminononan-2-one;butan-2-imine |
| PubChem CID | 156646754 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | (3R)-3-aminononan-2-one;butan-2-imine |
| SMILES | CCCCCC[C@@H](N)C(C)=O.[H]/N=C(\C)CC |
| InChI | InChI=1S/C9H19NO.C4H9N/c1-3-4-5-6-7-9(10)8(2)11;1-3-4(2)5/h9H,3-7,10H2,1-2H3;5H,3H2,1-2H3/b;5-4+/t9-;/m1./s1 |
| InChIKey | NWZKNRZUHVTLNM-ARUHLAMDSA-N |
| XLogP | 3.31 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-aminononan-2-one;butan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-aminononan-2-one;butan-2-imine?
The IUPAC name of (3R)-3-aminononan-2-one;butan-2-imine (CID 156646754) is (3R)-3-aminononan-2-one;butan-2-imine.
What is the SMILES notation for (3R)-3-aminononan-2-one;butan-2-imine?
The canonical SMILES for (3R)-3-aminononan-2-one;butan-2-imine is CCCCCC[C@@H](N)C(C)=O.[H]/N=C(\C)CC.
What is the InChIKey of (3R)-3-aminononan-2-one;butan-2-imine?
The InChIKey is NWZKNRZUHVTLNM-ARUHLAMDSA-N. The full InChI is InChI=1S/C9H19NO.C4H9N/c1-3-4-5-6-7-9(10)8(2)11;1-3-4(2)5/h9H,3-7,10H2,1-2H3;5H,3H2,1-2H3/b;5-4+/t9-;/m1./s1.
What are the key properties of (3R)-3-aminononan-2-one;butan-2-imine?
(3R)-3-aminononan-2-one;butan-2-imine has a molecular weight of 228.38 g/mol, XLogP of 3.31, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-aminononan-2-one;butan-2-imine is sourced from PubChem (CID 156646754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).