C23H41NO7 — CID 156647076
2-(5,6-dimethyl-4-methylideneoxan-2-yl)-N-[[4-hydroxy-6-(3-hydroxy-2-methoxypropyl)-5,5-dimethyloxan-2-yl]-methoxymethyl]acetamide (PubChem CID 156647076) has the molecular formula C23H41NO7 and a molecular weight of 443.58 g/mol. Its IUPAC name is 2-(5,6-dimethyl-4-methylideneoxan-2-yl)-N-[[4-hydroxy-6-(3-hydroxy-2-methoxypropyl)-5,5-dimethyloxan-2-yl]-methoxymethyl]acetamide.
| Compound Name | 2-(5,6-dimethyl-4-methylideneoxan-2-yl)-N-[[4-hydroxy-6-(3-hydroxy-2-methoxypropyl)-5,5-dimethyloxan-2-yl]-methoxymethyl]acetamide |
|---|---|
| PubChem CID | 156647076 |
| Molecular Formula | C23H41NO7 |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | 2-(5,6-dimethyl-4-methylideneoxan-2-yl)-N-[[4-hydroxy-6-(3-hydroxy-2-methoxypropyl)-5,5-dimethyloxan-2-yl]-methoxymethyl]acetamide |
| SMILES | C=C1CC(CC(=O)NC(OC)C2CC(O)C(C)(C)C(CC(CO)OC)O2)OC(C)C1C |
| InChI | InChI=1S/C23H41NO7/c1-13-8-16(30-15(3)14(13)2)10-21(27)24-22(29-7)18-11-19(26)23(4,5)20(31-18)9-17(12-25)28-6/h14-20,22,25-26H,1,8-12H2,2-7H3,(H,24,27) |
| InChIKey | AZKXGXZDLDMNFL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|