About ethyl 5-bromo-1-fluorosulfanyl-1,2,4-triazole-3-carboxylate
ethyl 5-bromo-1-fluorosulfanyl-1,2,4-triazole-3-carboxylate (PubChem CID 156647090) has the molecular formula C5H5BrFN3O2S
and a molecular weight of 270.08 g/mol. Its IUPAC name is ethyl 5-bromo-1-fluorosulfanyl-1,2,4-triazole-3-carboxylate.
Analyze ethyl 5-bromo-1-fluorosulfanyl-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-bromo-1-fluorosulfanyl-1,2,4-triazole-3-carboxylate?
The IUPAC name of ethyl 5-bromo-1-fluorosulfanyl-1,2,4-triazole-3-carboxylate (CID 156647090) is ethyl 5-bromo-1-fluorosulfanyl-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for ethyl 5-bromo-1-fluorosulfanyl-1,2,4-triazole-3-carboxylate?
The canonical SMILES for ethyl 5-bromo-1-fluorosulfanyl-1,2,4-triazole-3-carboxylate is CCOC(=O)c1nc(Br)n(SF)n1.
What is the InChIKey of ethyl 5-bromo-1-fluorosulfanyl-1,2,4-triazole-3-carboxylate?
The InChIKey is IZUVRPRAHFXYPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5BrFN3O2S/c1-2-12-4(11)3-8-5(6)10(9-3)13-7/h2H2,1H3.
What are the key properties of ethyl 5-bromo-1-fluorosulfanyl-1,2,4-triazole-3-carboxylate?
ethyl 5-bromo-1-fluorosulfanyl-1,2,4-triazole-3-carboxylate has a molecular weight of 270.08 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-bromo-1-fluorosulfanyl-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 156647090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).