C20H29BN2O2 — CID 156647461
3-pentyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine (PubChem CID 156647461) has the molecular formula C20H29BN2O2 and a molecular weight of 340.28 g/mol. Its IUPAC name is 3-pentyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine.
| Compound Name | 3-pentyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine |
|---|---|
| PubChem CID | 156647461 |
| Molecular Formula | C20H29BN2O2 |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 3-pentyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine |
| SMILES | CCCCCc1cc2ccc(B3OC(C)(C)C(C)(C)O3)cc2nc1N |
| InChI | InChI=1S/C20H29BN2O2/c1-6-7-8-9-15-12-14-10-11-16(13-17(14)23-18(15)22)21-24-19(2,3)20(4,5)25-21/h10-13H,6-9H2,1-5H3,(H2,22,23) |
| InChIKey | NKLPYPOLDPSVQI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|