C26H24F2N4O4 — CID 156648166
1-[(Z)-2-cyano-3-(2,4-difluorophenyl)prop-1-enyl]-3-[7-(3-hydroxy-3-methylbut-1-ynyl)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]urea (PubChem CID 156648166) has the molecular formula C26H24F2N4O4 and a molecular weight of 494.50 g/mol. Its IUPAC name is 1-[(Z)-2-cyano-3-(2,4-difluorophenyl)prop-1-enyl]-3-[7-(3-hydroxy-3-methylbut-1-ynyl)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]urea.
| Compound Name | 1-[(Z)-2-cyano-3-(2,4-difluorophenyl)prop-1-enyl]-3-[7-(3-hydroxy-3-methylbut-1-ynyl)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]urea |
|---|---|
| PubChem CID | 156648166 |
| Molecular Formula | C26H24F2N4O4 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 1-[(Z)-2-cyano-3-(2,4-difluorophenyl)prop-1-enyl]-3-[7-(3-hydroxy-3-methylbut-1-ynyl)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]urea |
| SMILES | CN1C(=O)C(NC(=O)N/C=C(\C#N)Cc2ccc(F)cc2F)COc2ccc(C#CC(C)(C)O)cc21 |
| InChI | InChI=1S/C26H24F2N4O4/c1-26(2,35)9-8-16-4-7-23-22(11-16)32(3)24(33)21(15-36-23)31-25(34)30-14-17(13-29)10-18-5-6-19(27)12-20(18)28/h4-7,11-12,14,21,35H,10,15H2,1-3H3,(H2,30,31,34)/b17-14- |
| InChIKey | IVGOPBJVGWEFJI-VKAVYKQESA-N |
| XLogP | 2.76 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|