C21H21FN2O — CID 156648659
6-(cyclohexa-1,3-dien-1-ylmethyl)-3-[(2-fluoro-N-methylanilino)methyl]pyridine-2-carbaldehyde (PubChem CID 156648659) has the molecular formula C21H21FN2O and a molecular weight of 336.41 g/mol. Its IUPAC name is 6-(cyclohexa-1,3-dien-1-ylmethyl)-3-[(2-fluoro-N-methylanilino)methyl]pyridine-2-carbaldehyde.
| Compound Name | 6-(cyclohexa-1,3-dien-1-ylmethyl)-3-[(2-fluoro-N-methylanilino)methyl]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 156648659 |
| Molecular Formula | C21H21FN2O |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 6-(cyclohexa-1,3-dien-1-ylmethyl)-3-[(2-fluoro-N-methylanilino)methyl]pyridine-2-carbaldehyde |
| SMILES | CN(Cc1ccc(CC2=CC=CCC2)nc1C=O)c1ccccc1F |
| InChI | InChI=1S/C21H21FN2O/c1-24(21-10-6-5-9-19(21)22)14-17-11-12-18(23-20(17)15-25)13-16-7-3-2-4-8-16/h2-3,5-7,9-12,15H,4,8,13-14H2,1H3 |
| InChIKey | LVQPLAYMZGDOBT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|