C8H11CeF3O2 — CID 156648922
cerium;(Z)-6,6,6-trifluoro-5-hydroxy-2,2-dimethylhex-4-en-3-one (PubChem CID 156648922) has the molecular formula C8H11CeF3O2 and a molecular weight of 336.28 g/mol. Its IUPAC name is cerium;(Z)-6,6,6-trifluoro-5-hydroxy-2,2-dimethylhex-4-en-3-one.
| Compound Name | cerium;(Z)-6,6,6-trifluoro-5-hydroxy-2,2-dimethylhex-4-en-3-one |
|---|---|
| PubChem CID | 156648922 |
| Molecular Formula | C8H11CeF3O2 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | cerium;(Z)-6,6,6-trifluoro-5-hydroxy-2,2-dimethylhex-4-en-3-one |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(F)(F)F.[Ce] |
| InChI | InChI=1S/C8H11F3O2.Ce/c1-7(2,3)5(12)4-6(13)8(9,10)11;/h4,13H,1-3H3;/b6-4-; |
| InChIKey | SHEZWGNVUIUQTQ-YHSAGPEESA-N |
| XLogP | 2.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|